C38H57N7O6 — CID 138528514
4-amino-1-[(2R)-6-amino-2-[[(2R)-4-methyl-2-[[3-phenyl-2-[[2-[[(2R)-2-phenylpropyl]amino]acetyl]amino]propanoyl]amino]pentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid (PubChem CID 138528514) has the molecular formula C38H57N7O6 and a molecular weight of 707.92 g/mol. Its IUPAC name is 4-amino-1-[(2R)-6-amino-2-[[(2R)-4-methyl-2-[[3-phenyl-2-[[2-[[(2R)-2-phenylpropyl]amino]acetyl]amino]propanoyl]amino]pentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-amino-1-[(2R)-6-amino-2-[[(2R)-4-methyl-2-[[3-phenyl-2-[[2-[[(2R)-2-phenylpropyl]amino]acetyl]amino]propanoyl]amino]pentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 138528514 |
| Molecular Formula | C38H57N7O6 |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | 4-amino-1-[(2R)-6-amino-2-[[(2R)-4-methyl-2-[[3-phenyl-2-[[2-[[(2R)-2-phenylpropyl]amino]acetyl]amino]propanoyl]amino]pentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C(Cc1ccccc1)NC(=O)CNC[C@H](C)c1ccccc1)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(C(=O)O)CC1 |
| InChI | InChI=1S/C38H57N7O6/c1-26(2)22-31(34(47)43-30(16-10-11-19-39)36(49)45-20-17-38(40,18-21-45)37(50)51)44-35(48)32(23-28-12-6-4-7-13-28)42-33(46)25-41-24-27(3)29-14-8-5-9-15-29/h4-9,12-15,26-27,30-32,41H,10-11,16-25,39-40H2,1-3H3,(H,42,46)(H,43,47)(H,44,48)(H,50,51)/t27-,30+,31+,32?/m0/s1 |
| InChIKey | AYIXVIHRKYGICQ-SSMLTGEISA-N |
| XLogP | 1.66 |
| TPSA | 208.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|