C38H56N6O6 — CID 139367134
4-amino-1-[(2R)-6-amino-2-[[(2R,4R,6R)-6-(2-aminoethylamino)-4-benzyl-2-(2-methylpropyl)-3,5-dioxo-7-phenylheptanoyl]amino]hexanoyl]piperidine-4-carboxylic acid (PubChem CID 139367134) has the molecular formula C38H56N6O6 and a molecular weight of 692.90 g/mol. Its IUPAC name is 4-amino-1-[(2R)-6-amino-2-[[(2R,4R,6R)-6-(2-aminoethylamino)-4-benzyl-2-(2-methylpropyl)-3,5-dioxo-7-phenylheptanoyl]amino]hexanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-amino-1-[(2R)-6-amino-2-[[(2R,4R,6R)-6-(2-aminoethylamino)-4-benzyl-2-(2-methylpropyl)-3,5-dioxo-7-phenylheptanoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 139367134 |
| Molecular Formula | C38H56N6O6 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.43 |
| IUPAC Name | 4-amino-1-[(2R)-6-amino-2-[[(2R,4R,6R)-6-(2-aminoethylamino)-4-benzyl-2-(2-methylpropyl)-3,5-dioxo-7-phenylheptanoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)CC(C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(C(=O)O)CC1)C(=O)[C@@H](Cc1ccccc1)C(=O)[C@@H](Cc1ccccc1)NCCN |
| InChI | InChI=1S/C38H56N6O6/c1-26(2)23-30(35(47)43-31(15-9-10-18-39)36(48)44-21-16-38(41,17-22-44)37(49)50)33(45)29(24-27-11-5-3-6-12-27)34(46)32(42-20-19-40)25-28-13-7-4-8-14-28/h3-8,11-14,26,29-32,42H,9-10,15-25,39-41H2,1-2H3,(H,43,47)(H,49,50)/t29-,30?,31-,32-/m1/s1 |
| InChIKey | LCEOUIWDVOOATH-VZMZSXMMSA-N |
| XLogP | 1.82 |
| TPSA | 210.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|