C15H19BrN4O3 — CID 138529899
N-[(4-bromophenyl)carbamoylamino]-N-[(1-methylcyclopentyl)carbamoyl]formamide (PubChem CID 138529899) has the molecular formula C15H19BrN4O3 and a molecular weight of 383.25 g/mol. Its IUPAC name is N-[(4-bromophenyl)carbamoylamino]-N-[(1-methylcyclopentyl)carbamoyl]formamide.
| Compound Name | N-[(4-bromophenyl)carbamoylamino]-N-[(1-methylcyclopentyl)carbamoyl]formamide |
|---|---|
| PubChem CID | 138529899 |
| Molecular Formula | C15H19BrN4O3 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[(4-bromophenyl)carbamoylamino]-N-[(1-methylcyclopentyl)carbamoyl]formamide |
| SMILES | CC1(NC(=O)N(C=O)NC(=O)Nc2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C15H19BrN4O3/c1-15(8-2-3-9-15)18-14(23)20(10-21)19-13(22)17-12-6-4-11(16)5-7-12/h4-7,10H,2-3,8-9H2,1H3,(H,18,23)(H2,17,19,22) |
| InChIKey | DDBUZBBLTFXPOZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|