C19H28BrN5O5 — CID 123974388
tert-butyl N-[3-[[[(4-bromophenyl)carbamoylamino]-formylcarbamoyl]amino]pentyl]carbamate (PubChem CID 123974388) has the molecular formula C19H28BrN5O5 and a molecular weight of 486.37 g/mol. Its IUPAC name is tert-butyl N-[3-[[[(4-bromophenyl)carbamoylamino]-formylcarbamoyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[3-[[[(4-bromophenyl)carbamoylamino]-formylcarbamoyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 123974388 |
| Molecular Formula | C19H28BrN5O5 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | tert-butyl N-[3-[[[(4-bromophenyl)carbamoylamino]-formylcarbamoyl]amino]pentyl]carbamate |
| SMILES | CCC(CCNC(=O)OC(C)(C)C)NC(=O)N(C=O)NC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H28BrN5O5/c1-5-14(10-11-21-18(29)30-19(2,3)4)23-17(28)25(12-26)24-16(27)22-15-8-6-13(20)7-9-15/h6-9,12,14H,5,10-11H2,1-4H3,(H,21,29)(H,23,28)(H2,22,24,27) |
| InChIKey | VWVRARMNAOGQBH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|