C17H25BrN2O4 — CID 118261852
tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[methoxy(methyl)amino]-4-oxobutan-2-yl]carbamate (PubChem CID 118261852) has the molecular formula C17H25BrN2O4 and a molecular weight of 401.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[methoxy(methyl)amino]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[methoxy(methyl)amino]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 118261852 |
| Molecular Formula | C17H25BrN2O4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[methoxy(methyl)amino]-4-oxobutan-2-yl]carbamate |
| SMILES | CON(C)C(=O)C[C@@H](Cc1ccc(Br)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25BrN2O4/c1-17(2,3)24-16(22)19-14(11-15(21)20(4)23-5)10-12-6-8-13(18)9-7-12/h6-9,14H,10-11H2,1-5H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | WWELBMIUOSBPOE-CQSZACIVSA-N |
| XLogP | 3.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|