C15H19F3N2O4 — CID 25139382
(3R)-N-methoxy-4-(4-methoxyphenyl)-N-methyl-3-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 25139382) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is (3R)-N-methoxy-4-(4-methoxyphenyl)-N-methyl-3-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | (3R)-N-methoxy-4-(4-methoxyphenyl)-N-methyl-3-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 25139382 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3R)-N-methoxy-4-(4-methoxyphenyl)-N-methyl-3-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | COc1ccc(C[C@H](CC(=O)N(C)OC)NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O4/c1-20(24-3)13(21)9-11(19-14(22)15(16,17)18)8-10-4-6-12(23-2)7-5-10/h4-7,11H,8-9H2,1-3H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | XQKIUMLSQOWSBC-LLVKDONJSA-N |
| XLogP | 1.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|