C14H18N4OS — CID 138529996
(1R)-2-(cyanoamino)-N-(5-cyclohexyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 138529996) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is (1R)-2-(cyanoamino)-N-(5-cyclohexyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | (1R)-2-(cyanoamino)-N-(5-cyclohexyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138529996 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (1R)-2-(cyanoamino)-N-(5-cyclohexyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | N#CNC1C[C@H]1C(=O)Nc1ncc(C2CCCCC2)s1 |
| InChI | InChI=1S/C14H18N4OS/c15-8-17-11-6-10(11)13(19)18-14-16-7-12(20-14)9-4-2-1-3-5-9/h7,9-11,17H,1-6H2,(H,16,18,19)/t10-,11?/m1/s1 |
| InChIKey | UTZJWNZTWUWTDR-NFJWQWPMSA-N |
| XLogP | 2.59 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|