C13H17N5O2S — CID 175514493
3-(cyanoamino)-N-[5-(1,3-oxazolidin-4-yl)-1,3-thiazol-2-yl]cyclopentane-1-carboxamide (PubChem CID 175514493) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-(cyanoamino)-N-[5-(1,3-oxazolidin-4-yl)-1,3-thiazol-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 3-(cyanoamino)-N-[5-(1,3-oxazolidin-4-yl)-1,3-thiazol-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 175514493 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-(cyanoamino)-N-[5-(1,3-oxazolidin-4-yl)-1,3-thiazol-2-yl]cyclopentane-1-carboxamide |
| SMILES | N#CNC1CCC(C(=O)Nc2ncc(C3COCN3)s2)C1 |
| InChI | InChI=1S/C13H17N5O2S/c14-6-16-9-2-1-8(3-9)12(19)18-13-15-4-11(21-13)10-5-20-7-17-10/h4,8-10,16-17H,1-3,5,7H2,(H,15,18,19) |
| InChIKey | IIQRYYIHKLKCAZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|