C15H20N4OS — CID 166970127
3-(cyanoamino)-N-[5-[(2S)-hex-5-en-2-yl]-1,3-thiazol-2-yl]cyclobutane-1-carboxamide (PubChem CID 166970127) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-(cyanoamino)-N-[5-[(2S)-hex-5-en-2-yl]-1,3-thiazol-2-yl]cyclobutane-1-carboxamide.
| Compound Name | 3-(cyanoamino)-N-[5-[(2S)-hex-5-en-2-yl]-1,3-thiazol-2-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 166970127 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-(cyanoamino)-N-[5-[(2S)-hex-5-en-2-yl]-1,3-thiazol-2-yl]cyclobutane-1-carboxamide |
| SMILES | C=CCC[C@H](C)c1cnc(NC(=O)C2CC(NC#N)C2)s1 |
| InChI | InChI=1S/C15H20N4OS/c1-3-4-5-10(2)13-8-17-15(21-13)19-14(20)11-6-12(7-11)18-9-16/h3,8,10-12,18H,1,4-7H2,2H3,(H,17,19,20)/t10-,11?,12?/m0/s1 |
| InChIKey | ZHGLZMFZLIJIRN-UNXYVOJBSA-N |
| XLogP | 3.00 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|