C17H18N4O2S — CID 155164788
3-(cyanoamino)-N-(7-cyclobutyloxy-1,3-benzothiazol-2-yl)cyclobutane-1-carboxamide (PubChem CID 155164788) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(cyanoamino)-N-(7-cyclobutyloxy-1,3-benzothiazol-2-yl)cyclobutane-1-carboxamide.
| Compound Name | 3-(cyanoamino)-N-(7-cyclobutyloxy-1,3-benzothiazol-2-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155164788 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-(cyanoamino)-N-(7-cyclobutyloxy-1,3-benzothiazol-2-yl)cyclobutane-1-carboxamide |
| SMILES | N#CNC1CC(C(=O)Nc2nc3cccc(OC4CCC4)c3s2)C1 |
| InChI | InChI=1S/C17H18N4O2S/c18-9-19-11-7-10(8-11)16(22)21-17-20-13-5-2-6-14(15(13)24-17)23-12-3-1-4-12/h2,5-6,10-12,19H,1,3-4,7-8H2,(H,20,21,22) |
| InChIKey | IHZBLEAWBBBEPD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|