C23H29N3O4 — CID 161340075
N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]cyclopentanecarboxamide;carbon dioxide (PubChem CID 161340075) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]cyclopentanecarboxamide;carbon dioxide.
| Compound Name | N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]cyclopentanecarboxamide;carbon dioxide |
|---|---|
| PubChem CID | 161340075 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]cyclopentanecarboxamide;carbon dioxide |
| SMILES | Cc1cc(N)c2c(OC3CCC(NC(=O)C4CCCC4)CC3)cccc2n1.O=C=O |
| InChI | InChI=1S/C22H29N3O2.CO2/c1-14-13-18(23)21-19(24-14)7-4-8-20(21)27-17-11-9-16(10-12-17)25-22(26)15-5-2-3-6-15;2-1-3/h4,7-8,13,15-17H,2-3,5-6,9-12H2,1H3,(H2,23,24)(H,25,26); |
| InChIKey | VMNWYPHVAIBEEV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |