C18H22BrN3O2 — CID 121442457
N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]-2-bromoacetamide (PubChem CID 121442457) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]-2-bromoacetamide.
| Compound Name | N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 121442457 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[4-(4-amino-2-methylquinolin-5-yl)oxycyclohexyl]-2-bromoacetamide |
| SMILES | Cc1cc(N)c2c(OC3CCC(NC(=O)CBr)CC3)cccc2n1 |
| InChI | InChI=1S/C18H22BrN3O2/c1-11-9-14(20)18-15(21-11)3-2-4-16(18)24-13-7-5-12(6-8-13)22-17(23)10-19/h2-4,9,12-13H,5-8,10H2,1H3,(H2,20,21)(H,22,23) |
| InChIKey | UIBVTIPENVDZEF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|