C23H31N3O6 — CID 121444091
4-amino-5-[4-[[2-(2-ethoxyethoxy)acetyl]amino]cyclohexyl]oxy-2-methylquinoline-3-carboxylic acid (PubChem CID 121444091) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-amino-5-[4-[[2-(2-ethoxyethoxy)acetyl]amino]cyclohexyl]oxy-2-methylquinoline-3-carboxylic acid.
| Compound Name | 4-amino-5-[4-[[2-(2-ethoxyethoxy)acetyl]amino]cyclohexyl]oxy-2-methylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 121444091 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-amino-5-[4-[[2-(2-ethoxyethoxy)acetyl]amino]cyclohexyl]oxy-2-methylquinoline-3-carboxylic acid |
| SMILES | CCOCCOCC(=O)NC1CCC(Oc2cccc3nc(C)c(C(=O)O)c(N)c23)CC1 |
| InChI | InChI=1S/C23H31N3O6/c1-3-30-11-12-31-13-19(27)26-15-7-9-16(10-8-15)32-18-6-4-5-17-21(18)22(24)20(23(28)29)14(2)25-17/h4-6,15-16H,3,7-13H2,1-2H3,(H2,24,25)(H,26,27)(H,28,29) |
| InChIKey | VSKFAYZAGAFJTE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|