C19H26N4O4 — CID 145077856
2-amino-N-cyclohexylacetamide;4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid (PubChem CID 145077856) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-amino-N-cyclohexylacetamide;4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid.
| Compound Name | 2-amino-N-cyclohexylacetamide;4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 145077856 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-amino-N-cyclohexylacetamide;4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid |
| SMILES | Cc1nc2cccc(O)c2c(N)c1C(=O)O.NCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H10N2O3.C8H16N2O/c1-5-8(11(15)16)10(12)9-6(13-5)3-2-4-7(9)14;9-6-8(11)10-7-4-2-1-3-5-7/h2-4,14H,1H3,(H2,12,13)(H,15,16);7H,1-6,9H2,(H,10,11) |
| InChIKey | YGCPBQQSIXOPKF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |