C20H22FN5O — CID 121442465
5-[4-[(5-fluoropyrimidin-2-yl)amino]cyclohexyl]oxy-2-methylquinolin-4-amine (PubChem CID 121442465) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-[4-[(5-fluoropyrimidin-2-yl)amino]cyclohexyl]oxy-2-methylquinolin-4-amine.
| Compound Name | 5-[4-[(5-fluoropyrimidin-2-yl)amino]cyclohexyl]oxy-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 121442465 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-[4-[(5-fluoropyrimidin-2-yl)amino]cyclohexyl]oxy-2-methylquinolin-4-amine |
| SMILES | Cc1cc(N)c2c(OC3CCC(Nc4ncc(F)cn4)CC3)cccc2n1 |
| InChI | InChI=1S/C20H22FN5O/c1-12-9-16(22)19-17(25-12)3-2-4-18(19)27-15-7-5-14(6-8-15)26-20-23-10-13(21)11-24-20/h2-4,9-11,14-15H,5-8H2,1H3,(H2,22,25)(H,23,24,26) |
| InChIKey | OYQVSRNFMLNGFA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |