C7H7FN2O2S — CID 175957268
N-(5-fluoro-1,3-thiazol-2-yl)oxetane-3-carboxamide (PubChem CID 175957268) has the molecular formula C7H7FN2O2S and a molecular weight of 202.21 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)oxetane-3-carboxamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 175957268 |
| Molecular Formula | C7H7FN2O2S |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)oxetane-3-carboxamide |
| SMILES | O=C(Nc1ncc(F)s1)C1COC1 |
| InChI | InChI=1S/C7H7FN2O2S/c8-5-1-9-7(13-5)10-6(11)4-2-12-3-4/h1,4H,2-3H2,(H,9,10,11) |
| InChIKey | PUGGDHJHRVJOHY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |