C11H7F8N3 — CID 138531979
1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrrol-2-yl]pyrazole (PubChem CID 138531979) has the molecular formula C11H7F8N3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrrol-2-yl]pyrazole.
| Compound Name | 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrrol-2-yl]pyrazole |
|---|---|
| PubChem CID | 138531979 |
| Molecular Formula | C11H7F8N3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrrol-2-yl]pyrazole |
| SMILES | Cn1cc(C(F)(F)F)c(C(F)(F)C(F)(F)F)c1-n1cccn1 |
| InChI | InChI=1S/C11H7F8N3/c1-21-5-6(10(14,15)16)7(9(12,13)11(17,18)19)8(21)22-4-2-3-20-22/h2-5H,1H3 |
| InChIKey | UUEADKMNFMPBRO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|