C25H25F2N7O2 — CID 138537235
2-cyclopropyl-1-[6-(1,1-difluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537235) has the molecular formula C25H25F2N7O2 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-cyclopropyl-1-[6-(1,1-difluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 2-cyclopropyl-1-[6-(1,1-difluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537235 |
| Molecular Formula | C25H25F2N7O2 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-cyclopropyl-1-[6-(1,1-difluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC(O)(c1cccc(-n2c3nc(Nc4ccc5c(c4)CCNC5)ncc3c(=O)n2C2CC2)n1)C(F)F |
| InChI | InChI=1S/C25H25F2N7O2/c1-25(36,23(26)27)19-3-2-4-20(31-19)34-21-18(22(35)33(34)17-7-8-17)13-29-24(32-21)30-16-6-5-15-12-28-10-9-14(15)11-16/h2-6,11,13,17,23,28,36H,7-10,12H2,1H3,(H,29,30,32) |
| InChIKey | BNKQELKCCPYUEM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |