C23H24FN7O2 — CID 138536679
2-cyclopropyl-1-[5-(2-fluoropropan-2-yl)-1,2-oxazol-3-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138536679) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-cyclopropyl-1-[5-(2-fluoropropan-2-yl)-1,2-oxazol-3-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 2-cyclopropyl-1-[5-(2-fluoropropan-2-yl)-1,2-oxazol-3-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138536679 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-cyclopropyl-1-[5-(2-fluoropropan-2-yl)-1,2-oxazol-3-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC(C)(F)c1cc(-n2c3nc(Nc4ccc5c(c4)CCNC5)ncc3c(=O)n2C2CC2)no1 |
| InChI | InChI=1S/C23H24FN7O2/c1-23(2,24)18-10-19(29-33-18)31-20-17(21(32)30(31)16-5-6-16)12-26-22(28-20)27-15-4-3-14-11-25-8-7-13(14)9-15/h3-4,9-10,12,16,25H,5-8,11H2,1-2H3,(H,26,27,28) |
| InChIKey | OEOLIAFERCALMR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |