C24H26FN7O2 — CID 155204310
2-cyclopropyl-1-[4-(1-fluoro-2-methylpropan-2-yl)-1,3-oxazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 155204310) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-(1-fluoro-2-methylpropan-2-yl)-1,3-oxazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 2-cyclopropyl-1-[4-(1-fluoro-2-methylpropan-2-yl)-1,3-oxazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 155204310 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-cyclopropyl-1-[4-(1-fluoro-2-methylpropan-2-yl)-1,3-oxazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC(C)(CF)c1coc(-n2c3nc(Nc4ccc5c(c4)CNCC5)ncc3c(=O)n2C2CC2)n1 |
| InChI | InChI=1S/C24H26FN7O2/c1-24(2,13-25)19-12-34-23(29-19)32-20-18(21(33)31(32)17-5-6-17)11-27-22(30-20)28-16-4-3-14-7-8-26-10-15(14)9-16/h3-4,9,11-12,17,26H,5-8,10,13H2,1-2H3,(H,27,28,30) |
| InChIKey | ROKWZDFNROLTPF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |