C24H28ClN7OS — CID 155193357
1-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyclopropyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one;hydrochloride (PubChem CID 155193357) has the molecular formula C24H28ClN7OS and a molecular weight of 498.06 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyclopropyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one;hydrochloride.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyclopropyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one;hydrochloride |
|---|---|
| PubChem CID | 155193357 |
| Molecular Formula | C24H28ClN7OS |
| Molecular Weight | 498.06 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyclopropyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one;hydrochloride |
| SMILES | CC(C)(C)c1csc(-n2c3nc(Nc4ccc5c(c4)CNCC5)ncc3c(=O)n2C2CC2)n1.Cl |
| InChI | InChI=1S/C24H27N7OS.ClH/c1-24(2,3)19-13-33-23(28-19)31-20-18(21(32)30(31)17-6-7-17)12-26-22(29-20)27-16-5-4-14-8-9-25-11-15(14)10-16;/h4-5,10,12-13,17,25H,6-9,11H2,1-3H3,(H,26,27,29);1H |
| InChIKey | JBRSYUNPBLWXRB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |