C24H25N7OS — CID 165103163
2-cyclopropyl-1-[4-(1-methylcyclopropyl)-1,3-thiazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 165103163) has the molecular formula C24H25N7OS and a molecular weight of 459.58 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-(1-methylcyclopropyl)-1,3-thiazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 2-cyclopropyl-1-[4-(1-methylcyclopropyl)-1,3-thiazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 165103163 |
| Molecular Formula | C24H25N7OS |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-cyclopropyl-1-[4-(1-methylcyclopropyl)-1,3-thiazol-2-yl]-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC1(c2csc(-n3c4nc(Nc5ccc6c(c5)CCNC6)ncc4c(=O)n3C3CC3)n2)CC1 |
| InChI | InChI=1S/C24H25N7OS/c1-24(7-8-24)19-13-33-23(28-19)31-20-18(21(32)30(31)17-4-5-17)12-26-22(29-20)27-16-3-2-15-11-25-9-6-14(15)10-16/h2-3,10,12-13,17,25H,4-9,11H2,1H3,(H,26,27,29) |
| InChIKey | OKIRMRNJANUPPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |