C10H12N2O4 — CID 138538614
3-hydroxy-4-methoxy-N-(1-oxopropan-2-yl)pyridine-2-carboxamide (PubChem CID 138538614) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-N-(1-oxopropan-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-4-methoxy-N-(1-oxopropan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138538614 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-hydroxy-4-methoxy-N-(1-oxopropan-2-yl)pyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)NC(C)C=O)c1O |
| InChI | InChI=1S/C10H12N2O4/c1-6(5-13)12-10(15)8-9(14)7(16-2)3-4-11-8/h3-6,14H,1-2H3,(H,12,15) |
| InChIKey | GIOGMCSHQBHNOW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|