C19H13N3O3 — CID 138543717
3-(4-oxo-5-phenyl-3H-pyrrolo[3,2-d]pyrimidin-7-yl)benzoic acid (PubChem CID 138543717) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-(4-oxo-5-phenyl-3H-pyrrolo[3,2-d]pyrimidin-7-yl)benzoic acid.
| Compound Name | 3-(4-oxo-5-phenyl-3H-pyrrolo[3,2-d]pyrimidin-7-yl)benzoic acid |
|---|---|
| PubChem CID | 138543717 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-(4-oxo-5-phenyl-3H-pyrrolo[3,2-d]pyrimidin-7-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cn(-c3ccccc3)c3c(=O)[nH]cnc23)c1 |
| InChI | InChI=1S/C19H13N3O3/c23-18-17-16(20-11-21-18)15(10-22(17)14-7-2-1-3-8-14)12-5-4-6-13(9-12)19(24)25/h1-11H,(H,24,25)(H,20,21,23) |
| InChIKey | VZJWNZTXFPYLLE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |