C25H29ClN2O3 — CID 138543845
3-chloro-N-[4-[1-[(2,2-dimethyloxan-4-yl)carbamoyl]cyclobutyl]phenyl]benzamide (PubChem CID 138543845) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is 3-chloro-N-[4-[1-[(2,2-dimethyloxan-4-yl)carbamoyl]cyclobutyl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[1-[(2,2-dimethyloxan-4-yl)carbamoyl]cyclobutyl]phenyl]benzamide |
|---|---|
| PubChem CID | 138543845 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-chloro-N-[4-[1-[(2,2-dimethyloxan-4-yl)carbamoyl]cyclobutyl]phenyl]benzamide |
| SMILES | CC1(C)CC(NC(=O)C2(c3ccc(NC(=O)c4cccc(Cl)c4)cc3)CCC2)CCO1 |
| InChI | InChI=1S/C25H29ClN2O3/c1-24(2)16-21(11-14-31-24)28-23(30)25(12-4-13-25)18-7-9-20(10-8-18)27-22(29)17-5-3-6-19(26)15-17/h3,5-10,15,21H,4,11-14,16H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | ALCFXCSKYMRKQL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |