C15H16Cl2N4O — CID 138544122
N-[1-(5-amino-2-pyridinyl)cyclobutyl]-6-chloropyridine-3-carboxamide;hydrochloride (PubChem CID 138544122) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is N-[1-(5-amino-2-pyridinyl)cyclobutyl]-6-chloropyridine-3-carboxamide;hydrochloride.
| Compound Name | N-[1-(5-amino-2-pyridinyl)cyclobutyl]-6-chloropyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 138544122 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[1-(5-amino-2-pyridinyl)cyclobutyl]-6-chloropyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(C2(NC(=O)c3ccc(Cl)nc3)CCC2)nc1 |
| InChI | InChI=1S/C15H15ClN4O.ClH/c16-13-5-2-10(8-19-13)14(21)20-15(6-1-7-15)12-4-3-11(17)9-18-12;/h2-5,8-9H,1,6-7,17H2,(H,20,21);1H |
| InChIKey | REYNAFCZJDXGNG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|