C33H33NO5S — CID 138550999
(4S)-4-(3,4,5-trimethoxyphenyl)-2-[2-[(S)-[4-(2,4,6-trimethylphenyl)phenyl]sulfinyl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 138550999) has the molecular formula C33H33NO5S and a molecular weight of 555.70 g/mol. Its IUPAC name is (4S)-4-(3,4,5-trimethoxyphenyl)-2-[2-[(S)-[4-(2,4,6-trimethylphenyl)phenyl]sulfinyl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-(3,4,5-trimethoxyphenyl)-2-[2-[(S)-[4-(2,4,6-trimethylphenyl)phenyl]sulfinyl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 138550999 |
| Molecular Formula | C33H33NO5S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (4S)-4-(3,4,5-trimethoxyphenyl)-2-[2-[(S)-[4-(2,4,6-trimethylphenyl)phenyl]sulfinyl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | COc1cc([C@H]2COC(c3ccccc3[S@@](=O)c3ccc(-c4c(C)cc(C)cc4C)cc3)=N2)cc(OC)c1OC |
| InChI | InChI=1S/C33H33NO5S/c1-20-15-21(2)31(22(3)16-20)23-11-13-25(14-12-23)40(35)30-10-8-7-9-26(30)33-34-27(19-39-33)24-17-28(36-4)32(38-6)29(18-24)37-5/h7-18,27H,19H2,1-6H3/t27-,40+/m1/s1 |
| InChIKey | QJMWQZGQJXZTQK-NBSZDIBVSA-N |
| XLogP | 6.99 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |