About 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one
4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one (PubChem CID 149432517) has the molecular formula C22H15NO2
and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one.
Molecular Properties
| Compound Name | 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one |
| PubChem CID | 149432517 |
| Molecular Formula | C22H15NO2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2c1cccc2C1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C22H15NO2/c24-21-16-10-5-4-9-15(16)20-17(21)11-6-12-18(20)22-23-19(13-25-22)14-7-2-1-3-8-14/h1-12,19H,13H2/t19-/m1/s1 |
| InChIKey | RGRHOZXRGVWPAS-LJQANCHMSA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one?
The IUPAC name of 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one (CID 149432517) is 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one.
What is the SMILES notation for 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one?
The canonical SMILES for 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one is O=C1c2ccccc2-c2c1cccc2C1=N[C@@H](c2ccccc2)CO1.
What is the InChIKey of 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one?
The InChIKey is RGRHOZXRGVWPAS-LJQANCHMSA-N. The full InChI is InChI=1S/C22H15NO2/c24-21-16-10-5-4-9-15(16)20-17(21)11-6-12-18(20)22-23-19(13-25-22)14-7-2-1-3-8-14/h1-12,19H,13H2/t19-/m1/s1.
What are the key properties of 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one?
4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one has a molecular weight of 325.37 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one is sourced from PubChem (CID 149432517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).