C16H12F3IMgN2O3S — CID 10529974
magnesium;[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-(trifluoromethylsulfonyl)azanide;iodide (PubChem CID 10529974) has the molecular formula C16H12F3IMgN2O3S and a molecular weight of 520.55 g/mol. Its IUPAC name is magnesium;[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-(trifluoromethylsulfonyl)azanide;iodide.
| Compound Name | magnesium;[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-(trifluoromethylsulfonyl)azanide;iodide |
|---|---|
| PubChem CID | 10529974 |
| Molecular Formula | C16H12F3IMgN2O3S |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | magnesium;[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-(trifluoromethylsulfonyl)azanide;iodide |
| SMILES | O=S(=O)([N-]c1ccccc1C1=N[C@H](c2ccccc2)CO1)C(F)(F)F.[I-].[Mg+2] |
| InChI | InChI=1S/C16H12F3N2O3S.HI.Mg/c17-16(18,19)25(22,23)21-13-9-5-4-8-12(13)15-20-14(10-24-15)11-6-2-1-3-7-11;;/h1-9,14H,10H2;1H;/q-1;;+2/p-1/t14-;;/m0../s1 |
| InChIKey | UOAVNDKGNRUYSL-UTLKBRERSA-M |
| XLogP | 0.68 |
| TPSA | 69.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|