C15H24N2O — CID 138551851
1-(4-ethoxyphenyl)-4,6-dimethyl-1,4-diazepane (PubChem CID 138551851) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-4,6-dimethyl-1,4-diazepane.
| Compound Name | 1-(4-ethoxyphenyl)-4,6-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 138551851 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(4-ethoxyphenyl)-4,6-dimethyl-1,4-diazepane |
| SMILES | CCOc1ccc(N2CCN(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C15H24N2O/c1-4-18-15-7-5-14(6-8-15)17-10-9-16(3)11-13(2)12-17/h5-8,13H,4,9-12H2,1-3H3 |
| InChIKey | FYDFCQTYMGUWEG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|