C22H29N3O2 — CID 138552247
1-[4-(4-ethoxyphenyl)-6-methyl-1,4-diazepan-1-yl]-3-pyridin-3-ylpropan-1-one (PubChem CID 138552247) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[4-(4-ethoxyphenyl)-6-methyl-1,4-diazepan-1-yl]-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[4-(4-ethoxyphenyl)-6-methyl-1,4-diazepan-1-yl]-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 138552247 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[4-(4-ethoxyphenyl)-6-methyl-1,4-diazepan-1-yl]-3-pyridin-3-ylpropan-1-one |
| SMILES | CCOc1ccc(N2CCN(C(=O)CCc3cccnc3)CC(C)C2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-3-27-21-9-7-20(8-10-21)24-13-14-25(17-18(2)16-24)22(26)11-6-19-5-4-12-23-15-19/h4-5,7-10,12,15,18H,3,6,11,13-14,16-17H2,1-2H3 |
| InChIKey | LFZZAFLWHSGIGI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|