About propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate
propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate (PubChem CID 138552553) has the molecular formula C17H24FN5O2
and a molecular weight of 349.41 g/mol. Its IUPAC name is propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate |
| PubChem CID | 138552553 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate |
| SMILES | CC(C)OC(=O)[C@@](N)(CC(C)(C)C)c1ccc(-n2cnnn2)c(F)c1 |
| InChI | InChI=1S/C17H24FN5O2/c1-11(2)25-15(24)17(19,9-16(3,4)5)12-6-7-14(13(18)8-12)23-10-20-21-22-23/h6-8,10-11H,9,19H2,1-5H3/t17-/m1/s1 |
| InChIKey | ARQRTTRLZZCZRJ-QGZVFWFLSA-N |
| XLogP | 2.34 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate?
The IUPAC name of propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate (CID 138552553) is propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate.
What is the SMILES notation for propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate?
The canonical SMILES for propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate is CC(C)OC(=O)[C@@](N)(CC(C)(C)C)c1ccc(-n2cnnn2)c(F)c1.
What is the InChIKey of propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate?
The InChIKey is ARQRTTRLZZCZRJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H24FN5O2/c1-11(2)25-15(24)17(19,9-16(3,4)5)12-6-7-14(13(18)8-12)23-10-20-21-22-23/h6-8,10-11H,9,19H2,1-5H3/t17-/m1/s1.
What are the key properties of propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate?
propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate has a molecular weight of 349.41 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R)-2-amino-2-[3-fluoro-4-(tetrazol-1-yl)phenyl]-4,4-dimethylpentanoate is sourced from PubChem (CID 138552553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).