C23H24N2O2 — CID 138553611
4-cyano-N-(1-spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-ylethyl)benzamide (PubChem CID 138553611) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-cyano-N-(1-spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-ylethyl)benzamide.
| Compound Name | 4-cyano-N-(1-spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-ylethyl)benzamide |
|---|---|
| PubChem CID | 138553611 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-cyano-N-(1-spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(C#N)cc1)C1CCC2(CC1)COc1ccccc12 |
| InChI | InChI=1S/C23H24N2O2/c1-16(25-22(26)19-8-6-17(14-24)7-9-19)18-10-12-23(13-11-18)15-27-21-5-3-2-4-20(21)23/h2-9,16,18H,10-13,15H2,1H3,(H,25,26) |
| InChIKey | LZTHCLSMEXUVNV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |