About 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol
4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol (PubChem CID 138556605) has the molecular formula C20H36O3
and a molecular weight of 324.50 g/mol. Its IUPAC name is 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol |
| PubChem CID | 138556605 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CC(C2CCC(O)CC2)C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C20H36O3/c21-17-7-1-14(2-8-17)13-20(15-3-9-18(22)10-4-15)16-5-11-19(23)12-6-16/h14-23H,1-13H2 |
| InChIKey | KIIXMMNHQXBIBF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol?
The IUPAC name of 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol (CID 138556605) is 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol?
The canonical SMILES for 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol is OC1CCC(CC(C2CCC(O)CC2)C2CCC(O)CC2)CC1.
What is the InChIKey of 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol?
The InChIKey is KIIXMMNHQXBIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O3/c21-17-7-1-14(2-8-17)13-20(15-3-9-18(22)10-4-15)16-5-11-19(23)12-6-16/h14-23H,1-13H2.
What are the key properties of 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol?
4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol has a molecular weight of 324.50 g/mol, XLogP of 3.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-bis(4-hydroxycyclohexyl)ethyl]cyclohexan-1-ol is sourced from PubChem (CID 138556605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).