C10H10FNO4S — CID 138558007
2-fluoro-5-(2-methyl-1,3-dioxol-2-yl)benzenesulfonamide (PubChem CID 138558007) has the molecular formula C10H10FNO4S and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-fluoro-5-(2-methyl-1,3-dioxol-2-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-(2-methyl-1,3-dioxol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 138558007 |
| Molecular Formula | C10H10FNO4S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-fluoro-5-(2-methyl-1,3-dioxol-2-yl)benzenesulfonamide |
| SMILES | CC1(c2ccc(F)c(S(N)(=O)=O)c2)OC=CO1 |
| InChI | InChI=1S/C10H10FNO4S/c1-10(15-4-5-16-10)7-2-3-8(11)9(6-7)17(12,13)14/h2-6H,1H3,(H2,12,13,14) |
| InChIKey | CQXUVLKWHDTCFY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |