C32H31N3 — CID 138565463
4-(3,6-ditert-butylcarbazol-9-yl)-2-pyridin-4-ylbenzonitrile (PubChem CID 138565463) has the molecular formula C32H31N3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-(3,6-ditert-butylcarbazol-9-yl)-2-pyridin-4-ylbenzonitrile.
| Compound Name | 4-(3,6-ditert-butylcarbazol-9-yl)-2-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 138565463 |
| Molecular Formula | C32H31N3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-(3,6-ditert-butylcarbazol-9-yl)-2-pyridin-4-ylbenzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C#N)c(-c2ccncc2)c1 |
| InChI | InChI=1S/C32H31N3/c1-31(2,3)23-8-11-29-27(17-23)28-18-24(32(4,5)6)9-12-30(28)35(29)25-10-7-22(20-33)26(19-25)21-13-15-34-16-14-21/h7-19H,1-6H3 |
| InChIKey | KEMLVGMFHMIMIX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |