C22H22ClN5 — CID 138566863
N'-[[3-[3-(4-chlorophenyl)imidazo[4,5-c]pyridin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine (PubChem CID 138566863) has the molecular formula C22H22ClN5 and a molecular weight of 391.91 g/mol. Its IUPAC name is N'-[[3-[3-(4-chlorophenyl)imidazo[4,5-c]pyridin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[[3-[3-(4-chlorophenyl)imidazo[4,5-c]pyridin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 138566863 |
| Molecular Formula | C22H22ClN5 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N'-[[3-[3-(4-chlorophenyl)imidazo[4,5-c]pyridin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCc1cccc(-c2nc3ccncc3n2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H22ClN5/c1-24-11-12-26-14-16-3-2-4-17(13-16)22-27-20-9-10-25-15-21(20)28(22)19-7-5-18(23)6-8-19/h2-10,13,15,24,26H,11-12,14H2,1H3 |
| InChIKey | BDXZKOSKPNDGCR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|