C32H50O — CID 138567781
2-[(4aR,6aS,6bR,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]acetaldehyde (PubChem CID 138567781) has the molecular formula C32H50O and a molecular weight of 450.75 g/mol. Its IUPAC name is 2-[(4aR,6aS,6bR,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]acetaldehyde.
| Compound Name | 2-[(4aR,6aS,6bR,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]acetaldehyde |
|---|---|
| PubChem CID | 138567781 |
| Molecular Formula | C32H50O |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 2-[(4aR,6aS,6bR,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]acetaldehyde |
| SMILES | C=C1CC[C@]2(C)C3CC=C4C5CC(C)(C)CC[C@]5(CC=O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C32H50O/c1-22-11-13-29(6)25(28(22,4)5)12-14-31(8)26(29)10-9-23-24-21-27(2,3)15-17-32(24,19-20-33)18-16-30(23,31)7/h9,20,24-26H,1,10-19,21H2,2-8H3/t24?,25-,26?,29-,30+,31+,32+/m0/s1 |
| InChIKey | VYPCWBBBUDWYIO-JPWXVVBZSA-N |
| XLogP | 8.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|