C11H15N — CID 138569673
2-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-3-methyl-1H-pyrrole (PubChem CID 138569673) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-3-methyl-1H-pyrrole.
| Compound Name | 2-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-3-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 138569673 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-3-methyl-1H-pyrrole |
| SMILES | C=C(C)/C(C)=C\c1[nH]ccc1C |
| InChI | InChI=1S/C11H15N/c1-8(2)10(4)7-11-9(3)5-6-12-11/h5-7,12H,1H2,2-4H3/b10-7- |
| InChIKey | QPHRCACMGKUUNT-YFHOEESVSA-N |
| XLogP | 3.30 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|