C25H37N3O6 — CID 138570566
N-hydroxy-4-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-2-azaspiro[4.5]decane-8-carbonyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 138570566) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-hydroxy-4-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-2-azaspiro[4.5]decane-8-carbonyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | N-hydroxy-4-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-2-azaspiro[4.5]decane-8-carbonyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 138570566 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-hydroxy-4-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-2-azaspiro[4.5]decane-8-carbonyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC(C)(C)OC(O)N1CCC2(CCC(C(=O)N3CCOc4cc(C(=O)NO)ccc4C3)CC2)C1 |
| InChI | InChI=1S/C25H37N3O6/c1-24(2,3)34-23(31)28-11-10-25(16-28)8-6-17(7-9-25)22(30)27-12-13-33-20-14-18(21(29)26-32)4-5-19(20)15-27/h4-5,14,17,23,31-32H,6-13,15-16H2,1-3H3,(H,26,29) |
| InChIKey | UXRPESRCOWSHJN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|