C17H23N3O5S — CID 138570606
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]-N-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide (PubChem CID 138570606) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]-N-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]-N-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide |
|---|---|
| PubChem CID | 138570606 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]-N-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CCCN(C(=O)CN1CCS(=O)(=O)CC1)C2 |
| InChI | InChI=1S/C17H23N3O5S/c21-16(12-19-6-8-26(24,25)9-7-19)20-5-1-2-13-10-14(17(22)18-23)3-4-15(13)11-20/h3-4,10,23H,1-2,5-9,11-12H2,(H,18,22) |
| InChIKey | KIJPMLLLRKMDPT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|