C16H22O4S — CID 138570997
ditert-butyl 4-sulfanylbenzene-1,2-dicarboxylate (PubChem CID 138570997) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is ditert-butyl 4-sulfanylbenzene-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-sulfanylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138570997 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | ditert-butyl 4-sulfanylbenzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(S)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22O4S/c1-15(2,3)19-13(17)11-8-7-10(21)9-12(11)14(18)20-16(4,5)6/h7-9,21H,1-6H3 |
| InChIKey | NJHAMNJJPVCBFS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|