About ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate
ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate (PubChem CID 100990281) has the molecular formula C32H42O9
and a molecular weight of 570.68 g/mol. Its IUPAC name is ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate |
| PubChem CID | 100990281 |
| Molecular Formula | C32H42O9 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Oc2ccc(C(=O)OC(C)(C)C)c(C(=O)OC(C)(C)C)c2)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42O9/c1-29(2,3)38-25(33)21-15-13-19(17-23(21)27(35)40-31(7,8)9)37-20-14-16-22(26(34)39-30(4,5)6)24(18-20)28(36)41-32(10,11)12/h13-18H,1-12H3 |
| InChIKey | NPLGLDAXMXKSLJ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate?
The IUPAC name of ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate (CID 100990281) is ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate is CC(C)(C)OC(=O)c1ccc(Oc2ccc(C(=O)OC(C)(C)C)c(C(=O)OC(C)(C)C)c2)cc1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate?
The InChIKey is NPLGLDAXMXKSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H42O9/c1-29(2,3)38-25(33)21-15-13-19(17-23(21)27(35)40-31(7,8)9)37-20-14-16-22(26(34)39-30(4,5)6)24(18-20)28(36)41-32(10,11)12/h13-18H,1-12H3.
What are the key properties of ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate?
ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate has a molecular weight of 570.68 g/mol, XLogP of 7.30, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]benzene-1,2-dicarboxylate is sourced from PubChem (CID 100990281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).