C16H20N2O4 — CID 118047572
tert-butyl 2-carbamimidoyl-4-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 118047572) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-4-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | tert-butyl 2-carbamimidoyl-4-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 118047572 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-4-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | [H]/N=C(\N)c1cc(OC(=O)C(=C)C)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20N2O4/c1-9(2)14(19)21-10-6-7-11(12(8-10)13(17)18)15(20)22-16(3,4)5/h6-8H,1H2,2-5H3,(H3,17,18) |
| InChIKey | GPNFUQMKWYTUOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|