C21H32N2O4 — CID 138571096
(3S)-N-hydroxy-3-methyl-4-[1-(2-propan-2-yloxan-4-yl)ethyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 138571096) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3S)-N-hydroxy-3-methyl-4-[1-(2-propan-2-yloxan-4-yl)ethyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | (3S)-N-hydroxy-3-methyl-4-[1-(2-propan-2-yloxan-4-yl)ethyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 138571096 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (3S)-N-hydroxy-3-methyl-4-[1-(2-propan-2-yloxan-4-yl)ethyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC(C)C1CC(C(C)N2Cc3ccc(C(=O)NO)cc3OC[C@@H]2C)CCO1 |
| InChI | InChI=1S/C21H32N2O4/c1-13(2)19-9-16(7-8-26-19)15(4)23-11-18-6-5-17(21(24)22-25)10-20(18)27-12-14(23)3/h5-6,10,13-16,19,25H,7-9,11-12H2,1-4H3,(H,22,24)/t14-,15?,16?,19?/m0/s1 |
| InChIKey | UHKJRNGTNCFGNG-DKWICNMVSA-N |
| XLogP | 3.23 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|