C9H14BrN3O — CID 138571158
N'-(6-bromo-2-methoxy-3-pyridinyl)-N-methylethane-1,2-diamine (PubChem CID 138571158) has the molecular formula C9H14BrN3O and a molecular weight of 260.13 g/mol. Its IUPAC name is N'-(6-bromo-2-methoxy-3-pyridinyl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(6-bromo-2-methoxy-3-pyridinyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 138571158 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | N'-(6-bromo-2-methoxy-3-pyridinyl)-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1ccc(Br)nc1OC |
| InChI | InChI=1S/C9H14BrN3O/c1-11-5-6-12-7-3-4-8(10)13-9(7)14-2/h3-4,11-12H,5-6H2,1-2H3 |
| InChIKey | ZYPRXGVCNORLDY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|