C18H27NO — CID 138571916
(6S)-2,2,6-trimethyl-N-(2-phenylethyl)cyclohexane-1-carboxamide (PubChem CID 138571916) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (6S)-2,2,6-trimethyl-N-(2-phenylethyl)cyclohexane-1-carboxamide.
| Compound Name | (6S)-2,2,6-trimethyl-N-(2-phenylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 138571916 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (6S)-2,2,6-trimethyl-N-(2-phenylethyl)cyclohexane-1-carboxamide |
| SMILES | C[C@H]1CCCC(C)(C)C1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H27NO/c1-14-8-7-12-18(2,3)16(14)17(20)19-13-11-15-9-5-4-6-10-15/h4-6,9-10,14,16H,7-8,11-13H2,1-3H3,(H,19,20)/t14-,16?/m0/s1 |
| InChIKey | BEICMBYBCFEOBI-LBAUFKAWSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |