C23H26N4O2 — CID 138574645
1-[5-[7-[amino(hydroxy)methyl]-2,3,5-trimethyl-1H-pyrrolo[2,3-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 138574645) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[5-[7-[amino(hydroxy)methyl]-2,3,5-trimethyl-1H-pyrrolo[2,3-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-[7-[amino(hydroxy)methyl]-2,3,5-trimethyl-1H-pyrrolo[2,3-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 138574645 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[5-[7-[amino(hydroxy)methyl]-2,3,5-trimethyl-1H-pyrrolo[2,3-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2c(cccc2-c2c(C)nc(C(N)O)c3[nH]c(C)c(C)c23)C1 |
| InChI | InChI=1S/C23H26N4O2/c1-5-18(28)27-10-9-16-15(11-27)7-6-8-17(16)20-14(4)26-22(23(24)29)21-19(20)12(2)13(3)25-21/h5-8,23,25,29H,1,9-11,24H2,2-4H3 |
| InChIKey | BZRIRROLNZIMLH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|