C25H22F3N3O2 — CID 130362836
3,6,6-trifluoro-4-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-5-yl)-5,7,8,9-tetrahydrocarbazole-1-carboxamide (PubChem CID 130362836) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 3,6,6-trifluoro-4-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-5-yl)-5,7,8,9-tetrahydrocarbazole-1-carboxamide.
| Compound Name | 3,6,6-trifluoro-4-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-5-yl)-5,7,8,9-tetrahydrocarbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362836 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3,6,6-trifluoro-4-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-5-yl)-5,7,8,9-tetrahydrocarbazole-1-carboxamide |
| SMILES | C=CC(=O)N1CCc2c(cccc2-c2c(F)cc(C(N)=O)c3[nH]c4c(c23)CC(F)(F)CC4)C1 |
| InChI | InChI=1S/C25H22F3N3O2/c1-2-20(32)31-9-7-14-13(12-31)4-3-5-15(14)21-18(26)10-16(24(29)33)23-22(21)17-11-25(27,28)8-6-19(17)30-23/h2-5,10,30H,1,6-9,11-12H2,(H2,29,33) |
| InChIKey | NOGNRPZAKMMEOO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|