C25H21FN4O2 — CID 130362776
4-(2-cyano-3,4-dihydro-1H-isoquinolin-5-yl)-3-fluoro-7-(2-hydroxyethyl)-9H-carbazole-1-carboxamide (PubChem CID 130362776) has the molecular formula C25H21FN4O2 and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-(2-cyano-3,4-dihydro-1H-isoquinolin-5-yl)-3-fluoro-7-(2-hydroxyethyl)-9H-carbazole-1-carboxamide.
| Compound Name | 4-(2-cyano-3,4-dihydro-1H-isoquinolin-5-yl)-3-fluoro-7-(2-hydroxyethyl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362776 |
| Molecular Formula | C25H21FN4O2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-(2-cyano-3,4-dihydro-1H-isoquinolin-5-yl)-3-fluoro-7-(2-hydroxyethyl)-9H-carbazole-1-carboxamide |
| SMILES | N#CN1CCc2c(cccc2-c2c(F)cc(C(N)=O)c3[nH]c4cc(CCO)ccc4c23)C1 |
| InChI | InChI=1S/C25H21FN4O2/c26-20-11-19(25(28)32)24-23(18-5-4-14(7-9-31)10-21(18)29-24)22(20)17-3-1-2-15-12-30(13-27)8-6-16(15)17/h1-5,10-11,29,31H,6-9,12H2,(H2,28,32) |
| InChIKey | NOTIICHTQDOPAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|